C10H13ClN2 — CID 105163768
1-(3-chloro-4-pyridinyl)-N,2-dimethylprop-2-en-1-amine (PubChem CID 105163768) has the molecular formula C10H13ClN2 and a molecular weight of 196.68 g/mol. Its IUPAC name is 1-(3-chloro-4-pyridinyl)-N,2-dimethylprop-2-en-1-amine.
| Compound Name | 1-(3-chloro-4-pyridinyl)-N,2-dimethylprop-2-en-1-amine |
|---|---|
| PubChem CID | 105163768 |
| Molecular Formula | C10H13ClN2 |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 1-(3-chloro-4-pyridinyl)-N,2-dimethylprop-2-en-1-amine |
| SMILES | C=C(C)C(NC)c1ccncc1Cl |
| InChI | InChI=1S/C10H13ClN2/c1-7(2)10(12-3)8-4-5-13-6-9(8)11/h4-6,10,12H,1H2,2-3H3 |
| InChIKey | YWXDALHVJIQAHV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|