C9H12ClFN2 — CID 62066014
1-(4-chloro-3-fluorophenyl)-N-methylethane-1,2-diamine (PubChem CID 62066014) has the molecular formula C9H12ClFN2 and a molecular weight of 202.66 g/mol. Its IUPAC name is 1-(4-chloro-3-fluorophenyl)-N-methylethane-1,2-diamine.
| Compound Name | 1-(4-chloro-3-fluorophenyl)-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 62066014 |
| Molecular Formula | C9H12ClFN2 |
| Molecular Weight | 202.66 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 1-(4-chloro-3-fluorophenyl)-N-methylethane-1,2-diamine |
| SMILES | CNC(CN)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C9H12ClFN2/c1-13-9(5-12)6-2-3-7(10)8(11)4-6/h2-4,9,13H,5,12H2,1H3 |
| InChIKey | OEZXGWAPWJPAIU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.66 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |