C11H12F4N2 — CID 105250399
[1-[2-fluoro-3-(trifluoromethyl)phenyl]-2-methylprop-2-enyl]hydrazine (PubChem CID 105250399) has the molecular formula C11H12F4N2 and a molecular weight of 248.22 g/mol. Its IUPAC name is [1-[2-fluoro-3-(trifluoromethyl)phenyl]-2-methylprop-2-enyl]hydrazine.
| Compound Name | [1-[2-fluoro-3-(trifluoromethyl)phenyl]-2-methylprop-2-enyl]hydrazine |
|---|---|
| PubChem CID | 105250399 |
| Molecular Formula | C11H12F4N2 |
| Molecular Weight | 248.22 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | [1-[2-fluoro-3-(trifluoromethyl)phenyl]-2-methylprop-2-enyl]hydrazine |
| SMILES | C=C(C)C(NN)c1cccc(C(F)(F)F)c1F |
| InChI | InChI=1S/C11H12F4N2/c1-6(2)10(17-16)7-4-3-5-8(9(7)12)11(13,14)15/h3-5,10,17H,1,16H2,2H3 |
| InChIKey | KKXHDTNTAYTJHT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.22 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|