C10H10F4N2 — CID 105250321
1-[2-fluoro-3-(trifluoromethyl)phenyl]prop-2-enylhydrazine (PubChem CID 105250321) has the molecular formula C10H10F4N2 and a molecular weight of 234.20 g/mol. Its IUPAC name is 1-[2-fluoro-3-(trifluoromethyl)phenyl]prop-2-enylhydrazine.
| Compound Name | 1-[2-fluoro-3-(trifluoromethyl)phenyl]prop-2-enylhydrazine |
|---|---|
| PubChem CID | 105250321 |
| Molecular Formula | C10H10F4N2 |
| Molecular Weight | 234.20 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 1-[2-fluoro-3-(trifluoromethyl)phenyl]prop-2-enylhydrazine |
| SMILES | C=CC(NN)c1cccc(C(F)(F)F)c1F |
| InChI | InChI=1S/C10H10F4N2/c1-2-8(16-15)6-4-3-5-7(9(6)11)10(12,13)14/h2-5,8,16H,1,15H2 |
| InChIKey | LPPABKWXCYHDQR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.20 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|