About 1-(difluoromethyl)-2-fluoro-3-(trifluoromethyl)benzene;hydrofluoride
1-(difluoromethyl)-2-fluoro-3-(trifluoromethyl)benzene;hydrofluoride (PubChem CID 174776412) has the molecular formula C8H5F7
and a molecular weight of 234.11 g/mol. Its IUPAC name is 1-(difluoromethyl)-2-fluoro-3-(trifluoromethyl)benzene;hydrofluoride.
Molecular Properties
| Compound Name | 1-(difluoromethyl)-2-fluoro-3-(trifluoromethyl)benzene;hydrofluoride |
| PubChem CID | 174776412 |
| Molecular Formula | C8H5F7 |
| Molecular Weight | 234.11 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 1-(difluoromethyl)-2-fluoro-3-(trifluoromethyl)benzene;hydrofluoride |
| SMILES | F.Fc1c(C(F)F)cccc1C(F)(F)F |
| InChI | InChI=1S/C8H4F6.FH/c9-6-4(7(10)11)2-1-3-5(6)8(12,13)14;/h1-3,7H;1H |
| InChIKey | WCOGMAWPZSIRQU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.11 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(difluoromethyl)-2-fluoro-3-(trifluoromethyl)benzene;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(difluoromethyl)-2-fluoro-3-(trifluoromethyl)benzene;hydrofluoride?
The IUPAC name of 1-(difluoromethyl)-2-fluoro-3-(trifluoromethyl)benzene;hydrofluoride (CID 174776412) is 1-(difluoromethyl)-2-fluoro-3-(trifluoromethyl)benzene;hydrofluoride.
What is the SMILES notation for 1-(difluoromethyl)-2-fluoro-3-(trifluoromethyl)benzene;hydrofluoride?
The canonical SMILES for 1-(difluoromethyl)-2-fluoro-3-(trifluoromethyl)benzene;hydrofluoride is F.Fc1c(C(F)F)cccc1C(F)(F)F.
What is the InChIKey of 1-(difluoromethyl)-2-fluoro-3-(trifluoromethyl)benzene;hydrofluoride?
The InChIKey is WCOGMAWPZSIRQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4F6.FH/c9-6-4(7(10)11)2-1-3-5(6)8(12,13)14;/h1-3,7H;1H.
What are the key properties of 1-(difluoromethyl)-2-fluoro-3-(trifluoromethyl)benzene;hydrofluoride?
1-(difluoromethyl)-2-fluoro-3-(trifluoromethyl)benzene;hydrofluoride has a molecular weight of 234.11 g/mol, XLogP of 3.93, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(difluoromethyl)-2-fluoro-3-(trifluoromethyl)benzene;hydrofluoride is sourced from PubChem (CID 174776412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).