C19H12Br2F8O — CID 151614865
1,5-dibromo-2,4-bis[2-fluoro-3-(trifluoromethyl)phenyl]pentan-3-one (PubChem CID 151614865) has the molecular formula C19H12Br2F8O and a molecular weight of 568.10 g/mol. Its IUPAC name is 1,5-dibromo-2,4-bis[2-fluoro-3-(trifluoromethyl)phenyl]pentan-3-one.
| Compound Name | 1,5-dibromo-2,4-bis[2-fluoro-3-(trifluoromethyl)phenyl]pentan-3-one |
|---|---|
| PubChem CID | 151614865 |
| Molecular Formula | C19H12Br2F8O |
| Molecular Weight | 568.10 g/mol |
| Exact Mass | 565.91 |
| IUPAC Name | 1,5-dibromo-2,4-bis[2-fluoro-3-(trifluoromethyl)phenyl]pentan-3-one |
| SMILES | O=C(C(CBr)c1cccc(C(F)(F)F)c1F)C(CBr)c1cccc(C(F)(F)F)c1F |
| InChI | InChI=1S/C19H12Br2F8O/c20-7-11(9-3-1-5-13(15(9)22)18(24,25)26)17(30)12(8-21)10-4-2-6-14(16(10)23)19(27,28)29/h1-6,11-12H,7-8H2 |
| InChIKey | QNGUYIHVCNMNFI-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.10 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|