C31H22Br2F6O3 — CID 174489086
1,5-dibromo-2,4-bis[3-phenyl-2-(trifluoromethoxy)phenyl]pentan-3-one (PubChem CID 174489086) has the molecular formula C31H22Br2F6O3 and a molecular weight of 716.31 g/mol. Its IUPAC name is 1,5-dibromo-2,4-bis[3-phenyl-2-(trifluoromethoxy)phenyl]pentan-3-one.
| Compound Name | 1,5-dibromo-2,4-bis[3-phenyl-2-(trifluoromethoxy)phenyl]pentan-3-one |
|---|---|
| PubChem CID | 174489086 |
| Molecular Formula | C31H22Br2F6O3 |
| Molecular Weight | 716.31 g/mol |
| Exact Mass | 713.98 |
| IUPAC Name | 1,5-dibromo-2,4-bis[3-phenyl-2-(trifluoromethoxy)phenyl]pentan-3-one |
| SMILES | O=C(C(CBr)c1cccc(-c2ccccc2)c1OC(F)(F)F)C(CBr)c1cccc(-c2ccccc2)c1OC(F)(F)F |
| InChI | InChI=1S/C31H22Br2F6O3/c32-17-25(23-15-7-13-21(19-9-3-1-4-10-19)28(23)41-30(34,35)36)27(40)26(18-33)24-16-8-14-22(20-11-5-2-6-12-20)29(24)42-31(37,38)39/h1-16,25-26H,17-18H2 |
| InChIKey | IWTLTGOOKUPJRH-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.31 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|