C16H14F3NO3 — CID 150225443
(2S)-2-amino-3-[4-[2-(trifluoromethoxy)phenyl]phenyl]propanoic acid (PubChem CID 150225443) has the molecular formula C16H14F3NO3 and a molecular weight of 325.29 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[2-(trifluoromethoxy)phenyl]phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-[2-(trifluoromethoxy)phenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 150225443 |
| Molecular Formula | C16H14F3NO3 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | (2S)-2-amino-3-[4-[2-(trifluoromethoxy)phenyl]phenyl]propanoic acid |
| SMILES | N[C@@H](Cc1ccc(-c2ccccc2OC(F)(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C16H14F3NO3/c17-16(18,19)23-14-4-2-1-3-12(14)11-7-5-10(6-8-11)9-13(20)15(21)22/h1-8,13H,9,20H2,(H,21,22)/t13-/m0/s1 |
| InChIKey | FUIZQBWDRDKPTN-ZDUSSCGKSA-N |
| XLogP | 3.21 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |