C17H17F3O — CID 118833201
1-(2-methylpropyl)-4-[2-(trifluoromethoxy)phenyl]benzene (PubChem CID 118833201) has the molecular formula C17H17F3O and a molecular weight of 294.32 g/mol. Its IUPAC name is 1-(2-methylpropyl)-4-[2-(trifluoromethoxy)phenyl]benzene.
| Compound Name | 1-(2-methylpropyl)-4-[2-(trifluoromethoxy)phenyl]benzene |
|---|---|
| PubChem CID | 118833201 |
| Molecular Formula | C17H17F3O |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 1-(2-methylpropyl)-4-[2-(trifluoromethoxy)phenyl]benzene |
| SMILES | CC(C)Cc1ccc(-c2ccccc2OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H17F3O/c1-12(2)11-13-7-9-14(10-8-13)15-5-3-4-6-16(15)21-17(18,19)20/h3-10,12H,11H2,1-2H3 |
| InChIKey | NHDDMIVSVPKELO-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |