C29H24Br2O — CID 141048792
1,5-dibromo-2,4-bis(4-phenylphenyl)pentan-3-one (PubChem CID 141048792) has the molecular formula C29H24Br2O and a molecular weight of 548.32 g/mol. Its IUPAC name is 1,5-dibromo-2,4-bis(4-phenylphenyl)pentan-3-one.
| Compound Name | 1,5-dibromo-2,4-bis(4-phenylphenyl)pentan-3-one |
|---|---|
| PubChem CID | 141048792 |
| Molecular Formula | C29H24Br2O |
| Molecular Weight | 548.32 g/mol |
| Exact Mass | 546.02 |
| IUPAC Name | 1,5-dibromo-2,4-bis(4-phenylphenyl)pentan-3-one |
| SMILES | O=C(C(CBr)c1ccc(-c2ccccc2)cc1)C(CBr)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H24Br2O/c30-19-27(25-15-11-23(12-16-25)21-7-3-1-4-8-21)29(32)28(20-31)26-17-13-24(14-18-26)22-9-5-2-6-10-22/h1-18,27-28H,19-20H2 |
| InChIKey | FKTKUPUMPMCXQR-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.32 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|