C19H20Br2O — CID 151406599
1,5-dibromo-2,4-bis(3-methylphenyl)pentan-3-one (PubChem CID 151406599) has the molecular formula C19H20Br2O and a molecular weight of 424.18 g/mol. Its IUPAC name is 1,5-dibromo-2,4-bis(3-methylphenyl)pentan-3-one.
| Compound Name | 1,5-dibromo-2,4-bis(3-methylphenyl)pentan-3-one |
|---|---|
| PubChem CID | 151406599 |
| Molecular Formula | C19H20Br2O |
| Molecular Weight | 424.18 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | 1,5-dibromo-2,4-bis(3-methylphenyl)pentan-3-one |
| SMILES | Cc1cccc(C(CBr)C(=O)C(CBr)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C19H20Br2O/c1-13-5-3-7-15(9-13)17(11-20)19(22)18(12-21)16-8-4-6-14(2)10-16/h3-10,17-18H,11-12H2,1-2H3 |
| InChIKey | OXQCECJRYHHUNC-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.18 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|