C21H30O — CID 145153760
1,1-bis(3-methylphenyl)propan-2-one;ethane (PubChem CID 145153760) has the molecular formula C21H30O and a molecular weight of 298.47 g/mol. Its IUPAC name is 1,1-bis(3-methylphenyl)propan-2-one;ethane.
| Compound Name | 1,1-bis(3-methylphenyl)propan-2-one;ethane |
|---|---|
| PubChem CID | 145153760 |
| Molecular Formula | C21H30O |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | 1,1-bis(3-methylphenyl)propan-2-one;ethane |
| SMILES | CC.CC.CC(=O)C(c1cccc(C)c1)c1cccc(C)c1 |
| InChI | InChI=1S/C17H18O.2C2H6/c1-12-6-4-8-15(10-12)17(14(3)18)16-9-5-7-13(2)11-16;2*1-2/h4-11,17H,1-3H3;2*1-2H3 |
| InChIKey | ZELSBEMQHJPOMB-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |