C7H9Cl2NS — CID 82758613
(1R)-1-(2,5-dichlorothiophen-3-yl)propan-1-amine (PubChem CID 82758613) has the molecular formula C7H9Cl2NS and a molecular weight of 210.13 g/mol. Its IUPAC name is (1R)-1-(2,5-dichlorothiophen-3-yl)propan-1-amine.
| Compound Name | (1R)-1-(2,5-dichlorothiophen-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 82758613 |
| Molecular Formula | C7H9Cl2NS |
| Molecular Weight | 210.13 g/mol |
| Exact Mass | 208.98 |
| IUPAC Name | (1R)-1-(2,5-dichlorothiophen-3-yl)propan-1-amine |
| SMILES | CC[C@@H](N)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C7H9Cl2NS/c1-2-5(10)4-3-6(8)11-7(4)9/h3,5H,2,10H2,1H3/t5-/m1/s1 |
| InChIKey | ZOODXNJEHUFUIG-RXMQYKEDSA-N |
| XLogP | 3.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.13 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |