C12H19Cl2NS — CID 43167354
1-(2,5-dichlorothiophen-3-yl)octan-1-amine (PubChem CID 43167354) has the molecular formula C12H19Cl2NS and a molecular weight of 280.26 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)octan-1-amine.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)octan-1-amine |
|---|---|
| PubChem CID | 43167354 |
| Molecular Formula | C12H19Cl2NS |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)octan-1-amine |
| SMILES | CCCCCCCC(N)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C12H19Cl2NS/c1-2-3-4-5-6-7-10(15)9-8-11(13)16-12(9)14/h8,10H,2-7,15H2,1H3 |
| InChIKey | MQUIGRISMBZOLM-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|