C14H23Br2NS — CID 65447630
1-(2,5-dibromothiophen-3-yl)decan-1-amine (PubChem CID 65447630) has the molecular formula C14H23Br2NS and a molecular weight of 397.22 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)decan-1-amine.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)decan-1-amine |
|---|---|
| PubChem CID | 65447630 |
| Molecular Formula | C14H23Br2NS |
| Molecular Weight | 397.22 g/mol |
| Exact Mass | 394.99 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)decan-1-amine |
| SMILES | CCCCCCCCCC(N)c1cc(Br)sc1Br |
| InChI | InChI=1S/C14H23Br2NS/c1-2-3-4-5-6-7-8-9-12(17)11-10-13(15)18-14(11)16/h10,12H,2-9,17H2,1H3 |
| InChIKey | UUTKZPMEUCVWNJ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.22 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|