C10H15Br2NO2S2 — CID 107968351
1-(2,5-dibromothiophen-3-yl)-4-ethylsulfonylbutan-1-amine (PubChem CID 107968351) has the molecular formula C10H15Br2NO2S2 and a molecular weight of 405.18 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-4-ethylsulfonylbutan-1-amine.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-4-ethylsulfonylbutan-1-amine |
|---|---|
| PubChem CID | 107968351 |
| Molecular Formula | C10H15Br2NO2S2 |
| Molecular Weight | 405.18 g/mol |
| Exact Mass | 402.89 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-4-ethylsulfonylbutan-1-amine |
| SMILES | CCS(=O)(=O)CCCC(N)c1cc(Br)sc1Br |
| InChI | InChI=1S/C10H15Br2NO2S2/c1-2-17(14,15)5-3-4-8(13)7-6-9(11)16-10(7)12/h6,8H,2-5,13H2,1H3 |
| InChIKey | KKGUIUQGOYPIEE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.18 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |