C12H19Br2NO2S2 — CID 107968354
1-(2,5-dibromothiophen-3-yl)-N-ethyl-4-ethylsulfonylbutan-1-amine (PubChem CID 107968354) has the molecular formula C12H19Br2NO2S2 and a molecular weight of 433.23 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-N-ethyl-4-ethylsulfonylbutan-1-amine.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-N-ethyl-4-ethylsulfonylbutan-1-amine |
|---|---|
| PubChem CID | 107968354 |
| Molecular Formula | C12H19Br2NO2S2 |
| Molecular Weight | 433.23 g/mol |
| Exact Mass | 430.92 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-N-ethyl-4-ethylsulfonylbutan-1-amine |
| SMILES | CCNC(CCCS(=O)(=O)CC)c1cc(Br)sc1Br |
| InChI | InChI=1S/C12H19Br2NO2S2/c1-3-15-10(6-5-7-19(16,17)4-2)9-8-11(13)18-12(9)14/h8,10,15H,3-7H2,1-2H3 |
| InChIKey | JHIGRIYTQWXSHS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.23 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |