C16H19Br2NS — CID 107968218
1-(2,5-dibromothiophen-3-yl)-N-ethyl-4-phenylbutan-1-amine (PubChem CID 107968218) has the molecular formula C16H19Br2NS and a molecular weight of 417.21 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-N-ethyl-4-phenylbutan-1-amine.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-N-ethyl-4-phenylbutan-1-amine |
|---|---|
| PubChem CID | 107968218 |
| Molecular Formula | C16H19Br2NS |
| Molecular Weight | 417.21 g/mol |
| Exact Mass | 414.96 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-N-ethyl-4-phenylbutan-1-amine |
| SMILES | CCNC(CCCc1ccccc1)c1cc(Br)sc1Br |
| InChI | InChI=1S/C16H19Br2NS/c1-2-19-14(13-11-15(17)20-16(13)18)10-6-9-12-7-4-3-5-8-12/h3-5,7-8,11,14,19H,2,6,9-10H2,1H3 |
| InChIKey | ABDXPVHIAOCZRR-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.21 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |