C11H17Cl2NS — CID 107968221
1-(2,5-dichlorothiophen-3-yl)-4,4-dimethylpentan-1-amine (PubChem CID 107968221) has the molecular formula C11H17Cl2NS and a molecular weight of 266.24 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)-4,4-dimethylpentan-1-amine.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)-4,4-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 107968221 |
| Molecular Formula | C11H17Cl2NS |
| Molecular Weight | 266.24 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)-4,4-dimethylpentan-1-amine |
| SMILES | CC(C)(C)CCC(N)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C11H17Cl2NS/c1-11(2,3)5-4-8(14)7-6-9(12)15-10(7)13/h6,8H,4-5,14H2,1-3H3 |
| InChIKey | DSWVZIVICXTZOE-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.24 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |