C10H15Cl2NS — CID 114874213
1-(2,5-dichlorothiophen-3-yl)-3-methylpentan-1-amine (PubChem CID 114874213) has the molecular formula C10H15Cl2NS and a molecular weight of 252.21 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)-3-methylpentan-1-amine.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)-3-methylpentan-1-amine |
|---|---|
| PubChem CID | 114874213 |
| Molecular Formula | C10H15Cl2NS |
| Molecular Weight | 252.21 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)-3-methylpentan-1-amine |
| SMILES | CCC(C)CC(N)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C10H15Cl2NS/c1-3-6(2)4-8(13)7-5-9(11)14-10(7)12/h5-6,8H,3-4,13H2,1-2H3 |
| InChIKey | XVEQBEOOGBKEGL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.21 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |