C14H21Cl2NO — CID 114874589
1-(2,5-dichloro-4-ethoxyphenyl)-3-methylpentan-1-amine (PubChem CID 114874589) has the molecular formula C14H21Cl2NO and a molecular weight of 290.23 g/mol. Its IUPAC name is 1-(2,5-dichloro-4-ethoxyphenyl)-3-methylpentan-1-amine.
| Compound Name | 1-(2,5-dichloro-4-ethoxyphenyl)-3-methylpentan-1-amine |
|---|---|
| PubChem CID | 114874589 |
| Molecular Formula | C14H21Cl2NO |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 1-(2,5-dichloro-4-ethoxyphenyl)-3-methylpentan-1-amine |
| SMILES | CCOc1cc(Cl)c(C(N)CC(C)CC)cc1Cl |
| InChI | InChI=1S/C14H21Cl2NO/c1-4-9(3)6-13(17)10-7-12(16)14(18-5-2)8-11(10)15/h7-9,13H,4-6,17H2,1-3H3 |
| InChIKey | IFXKQFGSUVIUDH-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |