C16H24Cl2O2 — CID 114876048
1-chloro-2-(1-chloro-3-methylpentyl)-4,5-diethoxybenzene (PubChem CID 114876048) has the molecular formula C16H24Cl2O2 and a molecular weight of 319.27 g/mol. Its IUPAC name is 1-chloro-2-(1-chloro-3-methylpentyl)-4,5-diethoxybenzene.
| Compound Name | 1-chloro-2-(1-chloro-3-methylpentyl)-4,5-diethoxybenzene |
|---|---|
| PubChem CID | 114876048 |
| Molecular Formula | C16H24Cl2O2 |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 1-chloro-2-(1-chloro-3-methylpentyl)-4,5-diethoxybenzene |
| SMILES | CCOc1cc(Cl)c(C(Cl)CC(C)CC)cc1OCC |
| InChI | InChI=1S/C16H24Cl2O2/c1-5-11(4)8-13(17)12-9-15(19-6-2)16(20-7-3)10-14(12)18/h9-11,13H,5-8H2,1-4H3 |
| InChIKey | IOAPRJXHCBQVNZ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|