3-(2-chloro-4,5-diethoxyphenyl)butanoic acid

C14H19ClO4 — CID 83959381

IUPAC3-(2-chloro-4,5-diethoxyphenyl)butanoic acid
SMILESCCOc1cc(Cl)c(C(C)CC(=O)O)cc1OCC
InChIInChI=1S/C14H19ClO4/c1-4-18-12-7-10(9(3)6-14(16)17)11(15)8-13(12)19-5-2/h7-9H,4-6H2,1-3H3,(H,16,17)
InChIKeyFUFDOSBGXDMKMY-UHFFFAOYSA-N
MW286.75 g/mol
LogP3.72
Rot. Bonds7

About 3-(2-chloro-4,5-diethoxyphenyl)butanoic acid

3-(2-chloro-4,5-diethoxyphenyl)butanoic acid (PubChem CID 83959381) has the molecular formula C14H19ClO4 and a molecular weight of 286.75 g/mol. Its IUPAC name is 3-(2-chloro-4,5-diethoxyphenyl)butanoic acid.

Molecular Properties

Compound Name3-(2-chloro-4,5-diethoxyphenyl)butanoic acid
PubChem CID83959381
Molecular FormulaC14H19ClO4
Molecular Weight286.75 g/mol
Exact Mass286.10
IUPAC Name3-(2-chloro-4,5-diethoxyphenyl)butanoic acid
SMILESCCOc1cc(Cl)c(C(C)CC(=O)O)cc1OCC
InChIInChI=1S/C14H19ClO4/c1-4-18-12-7-10(9(3)6-14(16)17)11(15)8-13(12)19-5-2/h7-9H,4-6H2,1-3H3,(H,16,17)
InChIKeyFUFDOSBGXDMKMY-UHFFFAOYSA-N
XLogP3.72
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.75
LogP ≤ 53.72
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(2-chloro-4,5-diethoxyphenyl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2-chloro-4,5-diethoxyphenyl)butanoic acid?
The IUPAC name of 3-(2-chloro-4,5-diethoxyphenyl)butanoic acid (CID 83959381) is 3-(2-chloro-4,5-diethoxyphenyl)butanoic acid.
What is the SMILES notation for 3-(2-chloro-4,5-diethoxyphenyl)butanoic acid?
The canonical SMILES for 3-(2-chloro-4,5-diethoxyphenyl)butanoic acid is CCOc1cc(Cl)c(C(C)CC(=O)O)cc1OCC.
What is the InChIKey of 3-(2-chloro-4,5-diethoxyphenyl)butanoic acid?
The InChIKey is FUFDOSBGXDMKMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19ClO4/c1-4-18-12-7-10(9(3)6-14(16)17)11(15)8-13(12)19-5-2/h7-9H,4-6H2,1-3H3,(H,16,17).
What are the key properties of 3-(2-chloro-4,5-diethoxyphenyl)butanoic acid?
3-(2-chloro-4,5-diethoxyphenyl)butanoic acid has a molecular weight of 286.75 g/mol, XLogP of 3.72, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-chloro-4,5-diethoxyphenyl)butanoic acid is sourced from PubChem (CID 83959381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).