C14H19ClO4 — CID 83959381
3-(2-chloro-4,5-diethoxyphenyl)butanoic acid (PubChem CID 83959381) has the molecular formula C14H19ClO4 and a molecular weight of 286.75 g/mol. Its IUPAC name is 3-(2-chloro-4,5-diethoxyphenyl)butanoic acid.
| Compound Name | 3-(2-chloro-4,5-diethoxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 83959381 |
| Molecular Formula | C14H19ClO4 |
| Molecular Weight | 286.75 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 3-(2-chloro-4,5-diethoxyphenyl)butanoic acid |
| SMILES | CCOc1cc(Cl)c(C(C)CC(=O)O)cc1OCC |
| InChI | InChI=1S/C14H19ClO4/c1-4-18-12-7-10(9(3)6-14(16)17)11(15)8-13(12)19-5-2/h7-9H,4-6H2,1-3H3,(H,16,17) |
| InChIKey | FUFDOSBGXDMKMY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.75 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |