C13H18ClNO3 — CID 852887
N-(2-chloro-4,5-diethoxyphenyl)propanamide (PubChem CID 852887) has the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. Its IUPAC name is N-(2-chloro-4,5-diethoxyphenyl)propanamide.
| Compound Name | N-(2-chloro-4,5-diethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 852887 |
| Molecular Formula | C13H18ClNO3 |
| Molecular Weight | 271.74 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N-(2-chloro-4,5-diethoxyphenyl)propanamide |
| SMILES | CCOc1cc(Cl)c(NC(=O)CC)cc1OCC |
| InChI | InChI=1S/C13H18ClNO3/c1-4-13(16)15-10-8-12(18-6-3)11(17-5-2)7-9(10)14/h7-8H,4-6H2,1-3H3,(H,15,16) |
| InChIKey | MGLMRPHRCHTNLX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.74 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |