C19H21BrClNO3 — CID 31013760
2-(2-bromo-4,5-diethoxyphenyl)-N-(2-chloro-4-methylphenyl)acetamide (PubChem CID 31013760) has the molecular formula C19H21BrClNO3 and a molecular weight of 426.74 g/mol. Its IUPAC name is 2-(2-bromo-4,5-diethoxyphenyl)-N-(2-chloro-4-methylphenyl)acetamide.
| Compound Name | 2-(2-bromo-4,5-diethoxyphenyl)-N-(2-chloro-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 31013760 |
| Molecular Formula | C19H21BrClNO3 |
| Molecular Weight | 426.74 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | 2-(2-bromo-4,5-diethoxyphenyl)-N-(2-chloro-4-methylphenyl)acetamide |
| SMILES | CCOc1cc(Br)c(CC(=O)Nc2ccc(C)cc2Cl)cc1OCC |
| InChI | InChI=1S/C19H21BrClNO3/c1-4-24-17-9-13(14(20)11-18(17)25-5-2)10-19(23)22-16-7-6-12(3)8-15(16)21/h6-9,11H,4-5,10H2,1-3H3,(H,22,23) |
| InChIKey | OEPMNBYVIBVQLP-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.74 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |