C19H21BrN2O4 — CID 27667129
4-[[2-(2-bromo-4,5-diethoxyphenyl)acetyl]amino]benzamide (PubChem CID 27667129) has the molecular formula C19H21BrN2O4 and a molecular weight of 421.29 g/mol. Its IUPAC name is 4-[[2-(2-bromo-4,5-diethoxyphenyl)acetyl]amino]benzamide.
| Compound Name | 4-[[2-(2-bromo-4,5-diethoxyphenyl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 27667129 |
| Molecular Formula | C19H21BrN2O4 |
| Molecular Weight | 421.29 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 4-[[2-(2-bromo-4,5-diethoxyphenyl)acetyl]amino]benzamide |
| SMILES | CCOc1cc(Br)c(CC(=O)Nc2ccc(C(N)=O)cc2)cc1OCC |
| InChI | InChI=1S/C19H21BrN2O4/c1-3-25-16-9-13(15(20)11-17(16)26-4-2)10-18(23)22-14-7-5-12(6-8-14)19(21)24/h5-9,11H,3-4,10H2,1-2H3,(H2,21,24)(H,22,23) |
| InChIKey | SRAOKQUWTGPPTI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |