C21H25BrN2O6 — CID 35934164
N'-[2-(2-bromo-4,5-diethoxyphenyl)acetyl]-3,4-dimethoxybenzohydrazide (PubChem CID 35934164) has the molecular formula C21H25BrN2O6 and a molecular weight of 481.34 g/mol. Its IUPAC name is N'-[2-(2-bromo-4,5-diethoxyphenyl)acetyl]-3,4-dimethoxybenzohydrazide.
| Compound Name | N'-[2-(2-bromo-4,5-diethoxyphenyl)acetyl]-3,4-dimethoxybenzohydrazide |
|---|---|
| PubChem CID | 35934164 |
| Molecular Formula | C21H25BrN2O6 |
| Molecular Weight | 481.34 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | N'-[2-(2-bromo-4,5-diethoxyphenyl)acetyl]-3,4-dimethoxybenzohydrazide |
| SMILES | CCOc1cc(Br)c(CC(=O)NNC(=O)c2ccc(OC)c(OC)c2)cc1OCC |
| InChI | InChI=1S/C21H25BrN2O6/c1-5-29-18-10-14(15(22)12-19(18)30-6-2)11-20(25)23-24-21(26)13-7-8-16(27-3)17(9-13)28-4/h7-10,12H,5-6,11H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | ANIRTAKETCOIKD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|