C13H15BrClF3O2 — CID 63445001
1-(1-bromo-3,3,3-trifluoropropyl)-2-chloro-4,5-diethoxybenzene (PubChem CID 63445001) has the molecular formula C13H15BrClF3O2 and a molecular weight of 375.61 g/mol. Its IUPAC name is 1-(1-bromo-3,3,3-trifluoropropyl)-2-chloro-4,5-diethoxybenzene.
| Compound Name | 1-(1-bromo-3,3,3-trifluoropropyl)-2-chloro-4,5-diethoxybenzene |
|---|---|
| PubChem CID | 63445001 |
| Molecular Formula | C13H15BrClF3O2 |
| Molecular Weight | 375.61 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 1-(1-bromo-3,3,3-trifluoropropyl)-2-chloro-4,5-diethoxybenzene |
| SMILES | CCOc1cc(Cl)c(C(Br)CC(F)(F)F)cc1OCC |
| InChI | InChI=1S/C13H15BrClF3O2/c1-3-19-11-5-8(9(14)7-13(16,17)18)10(15)6-12(11)20-4-2/h5-6,9H,3-4,7H2,1-2H3 |
| InChIKey | ULNJUJVRAOIHMC-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.61 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|