C17H28ClNO2 — CID 63507198
1-(2-chloro-4,5-diethoxyphenyl)-N,2,2-trimethylbutan-1-amine (PubChem CID 63507198) has the molecular formula C17H28ClNO2 and a molecular weight of 313.87 g/mol. Its IUPAC name is 1-(2-chloro-4,5-diethoxyphenyl)-N,2,2-trimethylbutan-1-amine.
| Compound Name | 1-(2-chloro-4,5-diethoxyphenyl)-N,2,2-trimethylbutan-1-amine |
|---|---|
| PubChem CID | 63507198 |
| Molecular Formula | C17H28ClNO2 |
| Molecular Weight | 313.87 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 1-(2-chloro-4,5-diethoxyphenyl)-N,2,2-trimethylbutan-1-amine |
| SMILES | CCOc1cc(Cl)c(C(NC)C(C)(C)CC)cc1OCC |
| InChI | InChI=1S/C17H28ClNO2/c1-7-17(4,5)16(19-6)12-10-14(20-8-2)15(21-9-3)11-13(12)18/h10-11,16,19H,7-9H2,1-6H3 |
| InChIKey | ZNRGUOUXLILODT-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.87 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |