C13H15BrF4O2 — CID 79660552
4-(1-bromo-2,2,3,3-tetrafluoropropyl)-1,2-diethoxybenzene (PubChem CID 79660552) has the molecular formula C13H15BrF4O2 and a molecular weight of 359.16 g/mol. Its IUPAC name is 4-(1-bromo-2,2,3,3-tetrafluoropropyl)-1,2-diethoxybenzene.
| Compound Name | 4-(1-bromo-2,2,3,3-tetrafluoropropyl)-1,2-diethoxybenzene |
|---|---|
| PubChem CID | 79660552 |
| Molecular Formula | C13H15BrF4O2 |
| Molecular Weight | 359.16 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 4-(1-bromo-2,2,3,3-tetrafluoropropyl)-1,2-diethoxybenzene |
| SMILES | CCOc1ccc(C(Br)C(F)(F)C(F)F)cc1OCC |
| InChI | InChI=1S/C13H15BrF4O2/c1-3-19-9-6-5-8(7-10(9)20-4-2)11(14)13(17,18)12(15)16/h5-7,11-12H,3-4H2,1-2H3 |
| InChIKey | LSYULKNCHISTSP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.16 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|