C19H22F3NO2 — CID 68775083
2-(3,4-diethoxyphenyl)-2-[4-(trifluoromethyl)phenyl]ethanamine (PubChem CID 68775083) has the molecular formula C19H22F3NO2 and a molecular weight of 353.38 g/mol. Its IUPAC name is 2-(3,4-diethoxyphenyl)-2-[4-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | 2-(3,4-diethoxyphenyl)-2-[4-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 68775083 |
| Molecular Formula | C19H22F3NO2 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 2-(3,4-diethoxyphenyl)-2-[4-(trifluoromethyl)phenyl]ethanamine |
| SMILES | CCOc1ccc(C(CN)c2ccc(C(F)(F)F)cc2)cc1OCC |
| InChI | InChI=1S/C19H22F3NO2/c1-3-24-17-10-7-14(11-18(17)25-4-2)16(12-23)13-5-8-15(9-6-13)19(20,21)22/h5-11,16H,3-4,12,23H2,1-2H3 |
| InChIKey | CCXYJUNJDQFRBL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |