C10H9BrCl2F2O — CID 103514645
1-(1-bromo-2,2-difluoroethyl)-2,5-dichloro-4-ethoxybenzene (PubChem CID 103514645) has the molecular formula C10H9BrCl2F2O and a molecular weight of 333.99 g/mol. Its IUPAC name is 1-(1-bromo-2,2-difluoroethyl)-2,5-dichloro-4-ethoxybenzene.
| Compound Name | 1-(1-bromo-2,2-difluoroethyl)-2,5-dichloro-4-ethoxybenzene |
|---|---|
| PubChem CID | 103514645 |
| Molecular Formula | C10H9BrCl2F2O |
| Molecular Weight | 333.99 g/mol |
| Exact Mass | 331.92 |
| IUPAC Name | 1-(1-bromo-2,2-difluoroethyl)-2,5-dichloro-4-ethoxybenzene |
| SMILES | CCOc1cc(Cl)c(C(Br)C(F)F)cc1Cl |
| InChI | InChI=1S/C10H9BrCl2F2O/c1-2-16-8-4-6(12)5(3-7(8)13)9(11)10(14)15/h3-4,9-10H,2H2,1H3 |
| InChIKey | AZGOLMGCLVTESG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.99 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|