C16H14Cl4O — CID 106863254
1,4-dichloro-2-[chloro-(2-chloro-4-methylphenyl)methyl]-5-ethoxybenzene (PubChem CID 106863254) has the molecular formula C16H14Cl4O and a molecular weight of 364.10 g/mol. Its IUPAC name is 1,4-dichloro-2-[chloro-(2-chloro-4-methylphenyl)methyl]-5-ethoxybenzene.
| Compound Name | 1,4-dichloro-2-[chloro-(2-chloro-4-methylphenyl)methyl]-5-ethoxybenzene |
|---|---|
| PubChem CID | 106863254 |
| Molecular Formula | C16H14Cl4O |
| Molecular Weight | 364.10 g/mol |
| Exact Mass | 361.98 |
| IUPAC Name | 1,4-dichloro-2-[chloro-(2-chloro-4-methylphenyl)methyl]-5-ethoxybenzene |
| SMILES | CCOc1cc(Cl)c(C(Cl)c2ccc(C)cc2Cl)cc1Cl |
| InChI | InChI=1S/C16H14Cl4O/c1-3-21-15-8-13(18)11(7-14(15)19)16(20)10-5-4-9(2)6-12(10)17/h4-8,16H,3H2,1-2H3 |
| InChIKey | QUJVDSCKOQLUSN-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.10 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|