C11H12BrF3O2 — CID 104661035
1-(3-bromo-4-ethoxyphenyl)-3,3,3-trifluoropropan-1-ol (PubChem CID 104661035) has the molecular formula C11H12BrF3O2 and a molecular weight of 313.11 g/mol. Its IUPAC name is 1-(3-bromo-4-ethoxyphenyl)-3,3,3-trifluoropropan-1-ol.
| Compound Name | 1-(3-bromo-4-ethoxyphenyl)-3,3,3-trifluoropropan-1-ol |
|---|---|
| PubChem CID | 104661035 |
| Molecular Formula | C11H12BrF3O2 |
| Molecular Weight | 313.11 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 1-(3-bromo-4-ethoxyphenyl)-3,3,3-trifluoropropan-1-ol |
| SMILES | CCOc1ccc(C(O)CC(F)(F)F)cc1Br |
| InChI | InChI=1S/C11H12BrF3O2/c1-2-17-10-4-3-7(5-8(10)12)9(16)6-11(13,14)15/h3-5,9,16H,2,6H2,1H3 |
| InChIKey | CPFWHEOJFJKPIM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.11 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |