C12H10BrClF6O — CID 103310796
2-bromo-4-[1-chloro-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-1-ethoxybenzene (PubChem CID 103310796) has the molecular formula C12H10BrClF6O and a molecular weight of 399.56 g/mol. Its IUPAC name is 2-bromo-4-[1-chloro-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-1-ethoxybenzene.
| Compound Name | 2-bromo-4-[1-chloro-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-1-ethoxybenzene |
|---|---|
| PubChem CID | 103310796 |
| Molecular Formula | C12H10BrClF6O |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 397.95 |
| IUPAC Name | 2-bromo-4-[1-chloro-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-1-ethoxybenzene |
| SMILES | CCOc1ccc(C(Cl)C(C(F)(F)F)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C12H10BrClF6O/c1-2-21-8-4-3-6(5-7(8)13)9(14)10(11(15,16)17)12(18,19)20/h3-5,9-10H,2H2,1H3 |
| InChIKey | YQQGKTOPGMHODA-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|