C16H22BrClO3 — CID 81329757
2-[bromo-(2-chloro-4,5-diethoxyphenyl)methyl]-5-methyloxolane (PubChem CID 81329757) has the molecular formula C16H22BrClO3 and a molecular weight of 377.71 g/mol. Its IUPAC name is 2-[bromo-(2-chloro-4,5-diethoxyphenyl)methyl]-5-methyloxolane.
| Compound Name | 2-[bromo-(2-chloro-4,5-diethoxyphenyl)methyl]-5-methyloxolane |
|---|---|
| PubChem CID | 81329757 |
| Molecular Formula | C16H22BrClO3 |
| Molecular Weight | 377.71 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 2-[bromo-(2-chloro-4,5-diethoxyphenyl)methyl]-5-methyloxolane |
| SMILES | CCOc1cc(Cl)c(C(Br)C2CCC(C)O2)cc1OCC |
| InChI | InChI=1S/C16H22BrClO3/c1-4-19-14-8-11(12(18)9-15(14)20-5-2)16(17)13-7-6-10(3)21-13/h8-10,13,16H,4-7H2,1-3H3 |
| InChIKey | QSFTXFODPHBJHB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.71 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|