C11H18Cl2N2S — CID 107970213
[1-(2,5-dichlorothiophen-3-yl)-4,4-dimethylpentyl]hydrazine (PubChem CID 107970213) has the molecular formula C11H18Cl2N2S and a molecular weight of 281.25 g/mol. Its IUPAC name is [1-(2,5-dichlorothiophen-3-yl)-4,4-dimethylpentyl]hydrazine.
| Compound Name | [1-(2,5-dichlorothiophen-3-yl)-4,4-dimethylpentyl]hydrazine |
|---|---|
| PubChem CID | 107970213 |
| Molecular Formula | C11H18Cl2N2S |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | [1-(2,5-dichlorothiophen-3-yl)-4,4-dimethylpentyl]hydrazine |
| SMILES | CC(C)(C)CCC(NN)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C11H18Cl2N2S/c1-11(2,3)5-4-8(15-14)7-6-9(12)16-10(7)13/h6,8,15H,4-5,14H2,1-3H3 |
| InChIKey | RSLHVNVKGOFTKY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|