C12H10Cl4N2S — CID 114022333
[2-(3,4-dichlorophenyl)-1-(2,5-dichlorothiophen-3-yl)ethyl]hydrazine (PubChem CID 114022333) has the molecular formula C12H10Cl4N2S and a molecular weight of 356.11 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)-1-(2,5-dichlorothiophen-3-yl)ethyl]hydrazine.
| Compound Name | [2-(3,4-dichlorophenyl)-1-(2,5-dichlorothiophen-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 114022333 |
| Molecular Formula | C12H10Cl4N2S |
| Molecular Weight | 356.11 g/mol |
| Exact Mass | 353.93 |
| IUPAC Name | [2-(3,4-dichlorophenyl)-1-(2,5-dichlorothiophen-3-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1ccc(Cl)c(Cl)c1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C12H10Cl4N2S/c13-8-2-1-6(3-9(8)14)4-10(18-17)7-5-11(15)19-12(7)16/h1-3,5,10,18H,4,17H2 |
| InChIKey | BQTLFCTZLJEDBU-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.11 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|