C14H12BrCl3N2 — CID 105296858
[1-(3-bromo-2-chlorophenyl)-2-(3,4-dichlorophenyl)ethyl]hydrazine (PubChem CID 105296858) has the molecular formula C14H12BrCl3N2 and a molecular weight of 394.53 g/mol. Its IUPAC name is [1-(3-bromo-2-chlorophenyl)-2-(3,4-dichlorophenyl)ethyl]hydrazine.
| Compound Name | [1-(3-bromo-2-chlorophenyl)-2-(3,4-dichlorophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105296858 |
| Molecular Formula | C14H12BrCl3N2 |
| Molecular Weight | 394.53 g/mol |
| Exact Mass | 391.92 |
| IUPAC Name | [1-(3-bromo-2-chlorophenyl)-2-(3,4-dichlorophenyl)ethyl]hydrazine |
| SMILES | NNC(Cc1ccc(Cl)c(Cl)c1)c1cccc(Br)c1Cl |
| InChI | InChI=1S/C14H12BrCl3N2/c15-10-3-1-2-9(14(10)18)13(20-19)7-8-4-5-11(16)12(17)6-8/h1-6,13,20H,7,19H2 |
| InChIKey | HEWLRIYLBVPRMG-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|