C10H12Cl2N4S — CID 107970457
[1-(2,5-dichlorothiophen-3-yl)-2-(1-methylimidazol-2-yl)ethyl]hydrazine (PubChem CID 107970457) has the molecular formula C10H12Cl2N4S and a molecular weight of 291.21 g/mol. Its IUPAC name is [1-(2,5-dichlorothiophen-3-yl)-2-(1-methylimidazol-2-yl)ethyl]hydrazine.
| Compound Name | [1-(2,5-dichlorothiophen-3-yl)-2-(1-methylimidazol-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 107970457 |
| Molecular Formula | C10H12Cl2N4S |
| Molecular Weight | 291.21 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | [1-(2,5-dichlorothiophen-3-yl)-2-(1-methylimidazol-2-yl)ethyl]hydrazine |
| SMILES | Cn1ccnc1CC(NN)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C10H12Cl2N4S/c1-16-3-2-14-9(16)5-7(15-13)6-4-8(11)17-10(6)12/h2-4,7,15H,5,13H2,1H3 |
| InChIKey | CIBLXROCTUBWEB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.21 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|