C9H12Cl2N2S — CID 107970341
1-(2,5-dichlorothiophen-3-yl)pent-4-enylhydrazine (PubChem CID 107970341) has the molecular formula C9H12Cl2N2S and a molecular weight of 251.18 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)pent-4-enylhydrazine.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)pent-4-enylhydrazine |
|---|---|
| PubChem CID | 107970341 |
| Molecular Formula | C9H12Cl2N2S |
| Molecular Weight | 251.18 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)pent-4-enylhydrazine |
| SMILES | C=CCCC(NN)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C9H12Cl2N2S/c1-2-3-4-7(13-12)6-5-8(10)14-9(6)11/h2,5,7,13H,1,3-4,12H2 |
| InChIKey | DUNDJJRNSJRZCP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.18 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|