C12H18Cl2N2S — CID 107970721
1-(2,5-dichlorothiophen-3-yl)oct-7-enylhydrazine (PubChem CID 107970721) has the molecular formula C12H18Cl2N2S and a molecular weight of 293.26 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)oct-7-enylhydrazine.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)oct-7-enylhydrazine |
|---|---|
| PubChem CID | 107970721 |
| Molecular Formula | C12H18Cl2N2S |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)oct-7-enylhydrazine |
| SMILES | C=CCCCCCC(NN)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C12H18Cl2N2S/c1-2-3-4-5-6-7-10(16-15)9-8-11(13)17-12(9)14/h2,8,10,16H,1,3-7,15H2 |
| InChIKey | NFCKKNRUDODJTE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|