C12H17BrCl2S — CID 82987916
3-(1-bromo-2-propylpentyl)-2,5-dichlorothiophene (PubChem CID 82987916) has the molecular formula C12H17BrCl2S and a molecular weight of 344.15 g/mol. Its IUPAC name is 3-(1-bromo-2-propylpentyl)-2,5-dichlorothiophene.
| Compound Name | 3-(1-bromo-2-propylpentyl)-2,5-dichlorothiophene |
|---|---|
| PubChem CID | 82987916 |
| Molecular Formula | C12H17BrCl2S |
| Molecular Weight | 344.15 g/mol |
| Exact Mass | 341.96 |
| IUPAC Name | 3-(1-bromo-2-propylpentyl)-2,5-dichlorothiophene |
| SMILES | CCCC(CCC)C(Br)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C12H17BrCl2S/c1-3-5-8(6-4-2)11(13)9-7-10(14)16-12(9)15/h7-8,11H,3-6H2,1-2H3 |
| InChIKey | AGUXLELEMSSGQJ-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.15 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|