C7H5Cl2NS — CID 107968460
1-(2,5-dichlorothiophen-3-yl)prop-2-yn-1-amine (PubChem CID 107968460) has the molecular formula C7H5Cl2NS and a molecular weight of 206.10 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)prop-2-yn-1-amine.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)prop-2-yn-1-amine |
|---|---|
| PubChem CID | 107968460 |
| Molecular Formula | C7H5Cl2NS |
| Molecular Weight | 206.10 g/mol |
| Exact Mass | 204.95 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)prop-2-yn-1-amine |
| SMILES | C#CC(N)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C7H5Cl2NS/c1-2-5(10)4-3-6(8)11-7(4)9/h1,3,5H,10H2 |
| InChIKey | BSZJLJBDNXUREB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.10 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|