C10H12Cl2OS — CID 107969888
1-(2,5-dichlorothiophen-3-yl)-4-methylpent-4-en-1-ol (PubChem CID 107969888) has the molecular formula C10H12Cl2OS and a molecular weight of 251.18 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)-4-methylpent-4-en-1-ol.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)-4-methylpent-4-en-1-ol |
|---|---|
| PubChem CID | 107969888 |
| Molecular Formula | C10H12Cl2OS |
| Molecular Weight | 251.18 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)-4-methylpent-4-en-1-ol |
| SMILES | C=C(C)CCC(O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C10H12Cl2OS/c1-6(2)3-4-8(13)7-5-9(11)14-10(7)12/h5,8,13H,1,3-4H2,2H3 |
| InChIKey | HMUGYMHREMYOJH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.18 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|