C14H14Cl2OS — CID 63427104
1-(2,5-dichlorothiophen-3-yl)-2-(2,5-dimethylphenyl)ethanol (PubChem CID 63427104) has the molecular formula C14H14Cl2OS and a molecular weight of 301.24 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)-2-(2,5-dimethylphenyl)ethanol.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)-2-(2,5-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 63427104 |
| Molecular Formula | C14H14Cl2OS |
| Molecular Weight | 301.24 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)-2-(2,5-dimethylphenyl)ethanol |
| SMILES | Cc1ccc(C)c(CC(O)c2cc(Cl)sc2Cl)c1 |
| InChI | InChI=1S/C14H14Cl2OS/c1-8-3-4-9(2)10(5-8)6-12(17)11-7-13(15)18-14(11)16/h3-5,7,12,17H,6H2,1-2H3 |
| InChIKey | CGGYEVOSUPKMBY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.24 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |