C16H12Cl2OS — CID 107965715
1-(2,5-dichlorothiophen-3-yl)-2-naphthalen-1-ylethanol (PubChem CID 107965715) has the molecular formula C16H12Cl2OS and a molecular weight of 323.24 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)-2-naphthalen-1-ylethanol.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)-2-naphthalen-1-ylethanol |
|---|---|
| PubChem CID | 107965715 |
| Molecular Formula | C16H12Cl2OS |
| Molecular Weight | 323.24 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)-2-naphthalen-1-ylethanol |
| SMILES | OC(Cc1cccc2ccccc12)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C16H12Cl2OS/c17-15-9-13(16(18)20-15)14(19)8-11-6-3-5-10-4-1-2-7-12(10)11/h1-7,9,14,19H,8H2 |
| InChIKey | ROPSRAJEPVOQQD-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.24 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |