C16H18ClNO — CID 64916180
1-(2-amino-4-chlorophenyl)-2-(2,5-dimethylphenyl)ethanol (PubChem CID 64916180) has the molecular formula C16H18ClNO and a molecular weight of 275.78 g/mol. Its IUPAC name is 1-(2-amino-4-chlorophenyl)-2-(2,5-dimethylphenyl)ethanol.
| Compound Name | 1-(2-amino-4-chlorophenyl)-2-(2,5-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 64916180 |
| Molecular Formula | C16H18ClNO |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 1-(2-amino-4-chlorophenyl)-2-(2,5-dimethylphenyl)ethanol |
| SMILES | Cc1ccc(C)c(CC(O)c2ccc(Cl)cc2N)c1 |
| InChI | InChI=1S/C16H18ClNO/c1-10-3-4-11(2)12(7-10)8-16(19)14-6-5-13(17)9-15(14)18/h3-7,9,16,19H,8,18H2,1-2H3 |
| InChIKey | HOGXDRWEJBOBOQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|