C10H10Cl2N2OS — CID 107969835
1-(2,5-dichlorothiophen-3-yl)-2-(1-methylpyrazol-3-yl)ethanol (PubChem CID 107969835) has the molecular formula C10H10Cl2N2OS and a molecular weight of 277.18 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)-2-(1-methylpyrazol-3-yl)ethanol.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)-2-(1-methylpyrazol-3-yl)ethanol |
|---|---|
| PubChem CID | 107969835 |
| Molecular Formula | C10H10Cl2N2OS |
| Molecular Weight | 277.18 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)-2-(1-methylpyrazol-3-yl)ethanol |
| SMILES | Cn1ccc(CC(O)c2cc(Cl)sc2Cl)n1 |
| InChI | InChI=1S/C10H10Cl2N2OS/c1-14-3-2-6(13-14)4-8(15)7-5-9(11)16-10(7)12/h2-3,5,8,15H,4H2,1H3 |
| InChIKey | VDNPZKQVMFQTDW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.18 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |