About 6-amino-6-(2,5-dimethylthiophen-3-yl)hexanamide
6-amino-6-(2,5-dimethylthiophen-3-yl)hexanamide (PubChem CID 60862006) has the molecular formula C12H20N2OS
and a molecular weight of 240.37 g/mol. Its IUPAC name is 6-amino-6-(2,5-dimethylthiophen-3-yl)hexanamide.
Molecular Properties
| Compound Name | 6-amino-6-(2,5-dimethylthiophen-3-yl)hexanamide |
| PubChem CID | 60862006 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 6-amino-6-(2,5-dimethylthiophen-3-yl)hexanamide |
| SMILES | Cc1cc(C(N)CCCCC(N)=O)c(C)s1 |
| InChI | InChI=1S/C12H20N2OS/c1-8-7-10(9(2)16-8)11(13)5-3-4-6-12(14)15/h7,11H,3-6,13H2,1-2H3,(H2,14,15) |
| InChIKey | KHRJGZJBNBISKF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-6-(2,5-dimethylthiophen-3-yl)hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-6-(2,5-dimethylthiophen-3-yl)hexanamide?
The IUPAC name of 6-amino-6-(2,5-dimethylthiophen-3-yl)hexanamide (CID 60862006) is 6-amino-6-(2,5-dimethylthiophen-3-yl)hexanamide.
What is the SMILES notation for 6-amino-6-(2,5-dimethylthiophen-3-yl)hexanamide?
The canonical SMILES for 6-amino-6-(2,5-dimethylthiophen-3-yl)hexanamide is Cc1cc(C(N)CCCCC(N)=O)c(C)s1.
What is the InChIKey of 6-amino-6-(2,5-dimethylthiophen-3-yl)hexanamide?
The InChIKey is KHRJGZJBNBISKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2OS/c1-8-7-10(9(2)16-8)11(13)5-3-4-6-12(14)15/h7,11H,3-6,13H2,1-2H3,(H2,14,15).
What are the key properties of 6-amino-6-(2,5-dimethylthiophen-3-yl)hexanamide?
6-amino-6-(2,5-dimethylthiophen-3-yl)hexanamide has a molecular weight of 240.37 g/mol, XLogP of 2.41, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-6-(2,5-dimethylthiophen-3-yl)hexanamide is sourced from PubChem (CID 60862006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).